| Name | 6-Benzoyl-2-naphthol |
| Synonyms | 6-Benzoyl-2-naphthol 6-BENZOYL-2-NAPHTHOL 6-Benzoylnaphthalene-2-ol ketone,6-hydroxy-2-naphthylphenyl 6-HYDROXY-2-NAPHTHYL PHENYL KETONE Phenyl(6-hydroxy-2-naphtyl) ketone 6-hydroxy-2-naphthyl phenyl ketone Ketone, 6-hydroxy-2-naphthyl phenyl (6-Hydroxy-2-naphthyl)(phenyl)methanone (6-hydroxynaphthalen-2-yl)(phenyl)methanone Methanone, (6-hydroxy-2-naphthalenyl) phenyl |
| CAS | 52222-87-4 |
| EINECS | 257-755-6 |
| InChI | InChI=1/C17H12O2/c18-16-9-8-13-10-15(7-6-14(13)11-16)17(19)12-4-2-1-3-5-12/h1-11,18H |
| Molecular Formula | C17H12O2 |
| Molar Mass | 248.28 |
| Density | 1.1290 (rough estimate) |
| Melting Point | 161-162 °C (lit.) |
| Boling Point | 351.35°C (rough estimate) |
| Flash Point | 193.3°C |
| Solubility | ethanol: soluble50mg/mL |
| Vapor Presure | 7.46E-09mmHg at 25°C |
| pKa | 8.77±0.40(Predicted) |
| Refractive Index | 1.6000 (estimate) |
| Hazard Symbols | Xi - Irritant![]() |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36 - Wear suitable protective clothing. |
| WGK Germany | 3 |
| RTECS | OB4360000 |
| Toxicity | otr-ham:kdy 80 mg/L BJCAAI 37,873,78 |
| category | flammable liquid |
| flammability hazard characteristics | flammable; combustion produces stimulating smoke |
| storage and transportation characteristics | ventilation and low temperature drying |
| fire extinguishing agent | dry powder, foam, sand, carbon dioxide, mist water |